About 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol
3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol (PubChem CID 106447308) has the molecular formula C13H29NO3
and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol |
| PubChem CID | 106447308 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol |
| SMILES | CC(C)COCCOC(CO)C(N)C(C)(C)C |
| InChI | InChI=1S/C13H29NO3/c1-10(2)9-16-6-7-17-11(8-15)12(14)13(3,4)5/h10-12,15H,6-9,14H2,1-5H3 |
| InChIKey | IULSJTRBHOOAHK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol?
The IUPAC name of 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol (CID 106447308) is 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol.
What is the SMILES notation for 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol?
The canonical SMILES for 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol is CC(C)COCCOC(CO)C(N)C(C)(C)C.
What is the InChIKey of 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol?
The InChIKey is IULSJTRBHOOAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO3/c1-10(2)9-16-6-7-17-11(8-15)12(14)13(3,4)5/h10-12,15H,6-9,14H2,1-5H3.
What are the key properties of 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol?
3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol has a molecular weight of 247.38 g/mol, XLogP of 1.41, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,4-dimethyl-2-[2-(2-methylpropoxy)ethoxy]pentan-1-ol is sourced from PubChem (CID 106447308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).