C7H13BrCl2O — CID 114772037
2-bromo-1,4-dichloro-3-propoxybutane (PubChem CID 114772037) has the molecular formula C7H13BrCl2O and a molecular weight of 263.99 g/mol. Its IUPAC name is 2-bromo-1,4-dichloro-3-propoxybutane.
| Compound Name | 2-bromo-1,4-dichloro-3-propoxybutane |
|---|---|
| PubChem CID | 114772037 |
| Molecular Formula | C7H13BrCl2O |
| Molecular Weight | 263.99 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 2-bromo-1,4-dichloro-3-propoxybutane |
| SMILES | CCCOC(CCl)C(Br)CCl |
| InChI | InChI=1S/C7H13BrCl2O/c1-2-3-11-7(5-10)6(8)4-9/h6-7H,2-5H2,1H3 |
| InChIKey | IKMJPBDSVCNCIT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.99 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|