About 1-propoxypropane-1-thiol
1-propoxypropane-1-thiol (PubChem CID 57215222) has the molecular formula C6H14OS
and a molecular weight of 134.24 g/mol. Its IUPAC name is 1-propoxypropane-1-thiol.
Molecular Properties
| Compound Name | 1-propoxypropane-1-thiol |
| PubChem CID | 57215222 |
| Molecular Formula | C6H14OS |
| Molecular Weight | 134.24 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1-propoxypropane-1-thiol |
| SMILES | CCCOC(S)CC |
| InChI | InChI=1S/C6H14OS/c1-3-5-7-6(8)4-2/h6,8H,3-5H2,1-2H3 |
| InChIKey | FEVAQPSAWHHZAS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxypropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxypropane-1-thiol?
The IUPAC name of 1-propoxypropane-1-thiol (CID 57215222) is 1-propoxypropane-1-thiol.
What is the SMILES notation for 1-propoxypropane-1-thiol?
The canonical SMILES for 1-propoxypropane-1-thiol is CCCOC(S)CC.
What is the InChIKey of 1-propoxypropane-1-thiol?
The InChIKey is FEVAQPSAWHHZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14OS/c1-3-5-7-6(8)4-2/h6,8H,3-5H2,1-2H3.
What are the key properties of 1-propoxypropane-1-thiol?
1-propoxypropane-1-thiol has a molecular weight of 134.24 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxypropane-1-thiol is sourced from PubChem (CID 57215222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).