C10H19Cl2IO2 — CID 114773276
2-(2-butoxyethoxy)-1,4-dichloro-3-iodobutane (PubChem CID 114773276) has the molecular formula C10H19Cl2IO2 and a molecular weight of 369.07 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-1,4-dichloro-3-iodobutane.
| Compound Name | 2-(2-butoxyethoxy)-1,4-dichloro-3-iodobutane |
|---|---|
| PubChem CID | 114773276 |
| Molecular Formula | C10H19Cl2IO2 |
| Molecular Weight | 369.07 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 2-(2-butoxyethoxy)-1,4-dichloro-3-iodobutane |
| SMILES | CCCCOCCOC(CCl)C(I)CCl |
| InChI | InChI=1S/C10H19Cl2IO2/c1-2-3-4-14-5-6-15-10(8-12)9(13)7-11/h9-10H,2-8H2,1H3 |
| InChIKey | XPHXMWQPCKPBNF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.07 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|