C14H27Cl2IO4 — CID 114775163
2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]-1,4-dichloro-3-iodobutane (PubChem CID 114775163) has the molecular formula C14H27Cl2IO4 and a molecular weight of 457.18 g/mol. Its IUPAC name is 2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]-1,4-dichloro-3-iodobutane.
| Compound Name | 2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]-1,4-dichloro-3-iodobutane |
|---|---|
| PubChem CID | 114775163 |
| Molecular Formula | C14H27Cl2IO4 |
| Molecular Weight | 457.18 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]-1,4-dichloro-3-iodobutane |
| SMILES | CCCCOCCOCCOCCOC(CCl)C(I)CCl |
| InChI | InChI=1S/C14H27Cl2IO4/c1-2-3-4-18-5-6-19-7-8-20-9-10-21-14(12-16)13(17)11-15/h13-14H,2-12H2,1H3 |
| InChIKey | YCLAVCQKIHHPAZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|