C18H18ClIO — CID 114773096
1-[1-(4-chlorophenyl)-2-iodoethoxy]-1,2,3,4-tetrahydronaphthalene (PubChem CID 114773096) has the molecular formula C18H18ClIO and a molecular weight of 412.70 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2-iodoethoxy]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-[1-(4-chlorophenyl)-2-iodoethoxy]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 114773096 |
| Molecular Formula | C18H18ClIO |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2-iodoethoxy]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Clc1ccc(C(CI)OC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18ClIO/c19-15-10-8-14(9-11-15)18(12-20)21-17-7-3-5-13-4-1-2-6-16(13)17/h1-2,4,6,8-11,17-18H,3,5,7,12H2 |
| InChIKey | BRUABXTZKMPNEO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|