C12H20F3IO — CID 114773879
1-(iodomethyl)-4-propan-2-yl-1-(2,2,2-trifluoroethoxy)cyclohexane (PubChem CID 114773879) has the molecular formula C12H20F3IO and a molecular weight of 364.19 g/mol. Its IUPAC name is 1-(iodomethyl)-4-propan-2-yl-1-(2,2,2-trifluoroethoxy)cyclohexane.
| Compound Name | 1-(iodomethyl)-4-propan-2-yl-1-(2,2,2-trifluoroethoxy)cyclohexane |
|---|---|
| PubChem CID | 114773879 |
| Molecular Formula | C12H20F3IO |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-(iodomethyl)-4-propan-2-yl-1-(2,2,2-trifluoroethoxy)cyclohexane |
| SMILES | CC(C)C1CCC(CI)(OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3IO/c1-9(2)10-3-5-11(7-16,6-4-10)17-8-12(13,14)15/h9-10H,3-8H2,1-2H3 |
| InChIKey | TXRRRYFLHVCHCD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|