About [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene
[1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene (PubChem CID 114774767) has the molecular formula C11H13BrF2O
and a molecular weight of 279.12 g/mol. Its IUPAC name is [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene.
Molecular Properties
| Compound Name | [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene |
| PubChem CID | 114774767 |
| Molecular Formula | C11H13BrF2O |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene |
| SMILES | CC(CBr)(OCC(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H13BrF2O/c1-11(8-12,15-7-10(13)14)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | ZPQQTKLCWXVLSZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene?
The IUPAC name of [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene (CID 114774767) is [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene.
What is the SMILES notation for [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene?
The canonical SMILES for [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene is CC(CBr)(OCC(F)F)c1ccccc1.
What is the InChIKey of [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene?
The InChIKey is ZPQQTKLCWXVLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrF2O/c1-11(8-12,15-7-10(13)14)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3.
What are the key properties of [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene?
[1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene has a molecular weight of 279.12 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-bromo-2-(2,2-difluoroethoxy)propan-2-yl]benzene is sourced from PubChem (CID 114774767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).