C13H16N2O — CID 114777662
2-amino-N-[3-(2,5-dimethylphenyl)prop-2-ynyl]acetamide (PubChem CID 114777662) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-amino-N-[3-(2,5-dimethylphenyl)prop-2-ynyl]acetamide.
| Compound Name | 2-amino-N-[3-(2,5-dimethylphenyl)prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 114777662 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-amino-N-[3-(2,5-dimethylphenyl)prop-2-ynyl]acetamide |
| SMILES | Cc1ccc(C)c(C#CCNC(=O)CN)c1 |
| InChI | InChI=1S/C13H16N2O/c1-10-5-6-11(2)12(8-10)4-3-7-15-13(16)9-14/h5-6,8H,7,9,14H2,1-2H3,(H,15,16) |
| InChIKey | TUDUINYPQYDLJM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|