C11H11Br — CID 126971803
2-(3-bromoprop-1-ynyl)-1,4-dimethylbenzene (PubChem CID 126971803) has the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. Its IUPAC name is 2-(3-bromoprop-1-ynyl)-1,4-dimethylbenzene.
| Compound Name | 2-(3-bromoprop-1-ynyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 126971803 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-(3-bromoprop-1-ynyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C#CCBr)c1 |
| InChI | InChI=1S/C11H11Br/c1-9-5-6-10(2)11(8-9)4-3-7-12/h5-6,8H,7H2,1-2H3 |
| InChIKey | SPYJMMXGSLQZOV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|