C13H16BrFN2O4 — CID 114779458
[4-(4-bromo-5-fluoro-2-nitrophenyl)-6,6-dimethylmorpholin-2-yl]methanol (PubChem CID 114779458) has the molecular formula C13H16BrFN2O4 and a molecular weight of 363.18 g/mol. Its IUPAC name is [4-(4-bromo-5-fluoro-2-nitrophenyl)-6,6-dimethylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-bromo-5-fluoro-2-nitrophenyl)-6,6-dimethylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114779458 |
| Molecular Formula | C13H16BrFN2O4 |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [4-(4-bromo-5-fluoro-2-nitrophenyl)-6,6-dimethylmorpholin-2-yl]methanol |
| SMILES | CC1(C)CN(c2cc(F)c(Br)cc2[N+](=O)[O-])CC(CO)O1 |
| InChI | InChI=1S/C13H16BrFN2O4/c1-13(2)7-16(5-8(6-18)21-13)11-4-10(15)9(14)3-12(11)17(19)20/h3-4,8,18H,5-7H2,1-2H3 |
| InChIKey | ORTVOROWAZAPAR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|