C15H29NO2 — CID 114779894
[4-(4-ethylcyclohexyl)-6,6-dimethylmorpholin-2-yl]methanol (PubChem CID 114779894) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is [4-(4-ethylcyclohexyl)-6,6-dimethylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-ethylcyclohexyl)-6,6-dimethylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114779894 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | [4-(4-ethylcyclohexyl)-6,6-dimethylmorpholin-2-yl]methanol |
| SMILES | CCC1CCC(N2CC(CO)OC(C)(C)C2)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-4-12-5-7-13(8-6-12)16-9-14(10-17)18-15(2,3)11-16/h12-14,17H,4-11H2,1-3H3 |
| InChIKey | CDOONELIVPUURI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |