C18H17N3O5S — CID 1147802
2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 1147802) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 1147802 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c19-27(25,26)13-7-5-12(6-8-13)9-10-20-16(22)11-21-17(23)14-3-1-2-4-15(14)18(21)24/h1-8H,9-11H2,(H,20,22)(H2,19,25,26) |
| InChIKey | RVBIHRGXDKNPKO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|