C15H17N3O5S2 — CID 10385283
4-sulfamoyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 10385283) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-sulfamoyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-sulfamoyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 10385283 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-sulfamoyl-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H17N3O5S2/c16-24(20,21)13-5-1-11(2-6-13)9-10-18-15(19)12-3-7-14(8-4-12)25(17,22)23/h1-8H,9-10H2,(H,18,19)(H2,16,20,21)(H2,17,22,23) |
| InChIKey | DTWPVNTYGDBHCV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |