C14H13FN2O3S — CID 4290
N-[(2-fluorophenyl)methyl]-4-sulfamoylbenzamide (PubChem CID 4290) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-sulfamoylbenzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 4290 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C14H13FN2O3S/c15-13-4-2-1-3-11(13)9-17-14(18)10-5-7-12(8-6-10)21(16,19)20/h1-8H,9H2,(H,17,18)(H2,16,19,20) |
| InChIKey | ULYMHSXFSKOHGH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |