About N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide
N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide (PubChem CID 4288) has the molecular formula C14H12F2N2O3S
and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide.
Molecular Properties
| Compound Name | N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide |
| PubChem CID | 4288 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C14H12F2N2O3S/c15-12-2-1-3-13(16)11(12)8-18-14(19)9-4-6-10(7-5-9)22(17,20)21/h1-7H,8H2,(H,18,19)(H2,17,20,21) |
| InChIKey | ZFNCKGXGCCDDFN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide?
The IUPAC name of N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide (CID 4288) is N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide.
What is the SMILES notation for N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide?
The canonical SMILES for N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide is NS(=O)(=O)c1ccc(C(=O)NCc2c(F)cccc2F)cc1.
What is the InChIKey of N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide?
The InChIKey is ZFNCKGXGCCDDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O3S/c15-12-2-1-3-13(16)11(12)8-18-14(19)9-4-6-10(7-5-9)22(17,20)21/h1-7H,8H2,(H,18,19)(H2,17,20,21).
What are the key properties of N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide?
N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide has a molecular weight of 326.32 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-difluorophenyl)methyl]-4-sulfamoylbenzamide is sourced from PubChem (CID 4288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).