C8H16BF3NO2- — CID 114781915
trifluoro-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]boranuide (PubChem CID 114781915) has the molecular formula C8H16BF3NO2- and a molecular weight of 226.03 g/mol. Its IUPAC name is trifluoro-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]boranuide.
| Compound Name | trifluoro-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]boranuide |
|---|---|
| PubChem CID | 114781915 |
| Molecular Formula | C8H16BF3NO2- |
| Molecular Weight | 226.03 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | trifluoro-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]boranuide |
| SMILES | CC1(C)CN(C[B-](F)(F)F)CC(CO)O1 |
| InChI | InChI=1S/C8H16BF3NO2/c1-8(2)5-13(6-9(10,11)12)3-7(4-14)15-8/h7,14H,3-6H2,1-2H3/q-1 |
| InChIKey | WIJRWQMYOFRDMS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.03 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|