C14H18N6O — CID 114786461
3-[[(5,6-dimethyl-1,2,4-triazin-3-yl)-methylamino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 114786461) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 3-[[(5,6-dimethyl-1,2,4-triazin-3-yl)-methylamino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[(5,6-dimethyl-1,2,4-triazin-3-yl)-methylamino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114786461 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-[[(5,6-dimethyl-1,2,4-triazin-3-yl)-methylamino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1nnc(N(C)Cc2cccc(/C(N)=N/O)c2)nc1C |
| InChI | InChI=1S/C14H18N6O/c1-9-10(2)17-18-14(16-9)20(3)8-11-5-4-6-12(7-11)13(15)19-21/h4-7,21H,8H2,1-3H3,(H2,15,19) |
| InChIKey | YAMJOWRPQPCTFL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|