C14H14N4O3 — CID 114788579
2-(3-oxo-1-quinazolin-2-ylpiperazin-2-yl)acetic acid (PubChem CID 114788579) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-(3-oxo-1-quinazolin-2-ylpiperazin-2-yl)acetic acid.
| Compound Name | 2-(3-oxo-1-quinazolin-2-ylpiperazin-2-yl)acetic acid |
|---|---|
| PubChem CID | 114788579 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(3-oxo-1-quinazolin-2-ylpiperazin-2-yl)acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1c1ncc2ccccc2n1 |
| InChI | InChI=1S/C14H14N4O3/c19-12(20)7-11-13(21)15-5-6-18(11)14-16-8-9-3-1-2-4-10(9)17-14/h1-4,8,11H,5-7H2,(H,15,21)(H,19,20) |
| InChIKey | TWCJMMQPABNQTH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |