C14H14N4S — CID 114789128
N-[1-(1,3-thiazol-2-yl)propyl]quinazolin-2-amine (PubChem CID 114789128) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)propyl]quinazolin-2-amine.
| Compound Name | N-[1-(1,3-thiazol-2-yl)propyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 114789128 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)propyl]quinazolin-2-amine |
| SMILES | CCC(Nc1ncc2ccccc2n1)c1nccs1 |
| InChI | InChI=1S/C14H14N4S/c1-2-11(13-15-7-8-19-13)17-14-16-9-10-5-3-4-6-12(10)18-14/h3-9,11H,2H2,1H3,(H,16,17,18) |
| InChIKey | GUGQVNKIETZSBY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |