C11H14FNO4S2 — CID 114791269
3-[cyclopropyl(ethyl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 114791269) has the molecular formula C11H14FNO4S2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-[cyclopropyl(ethyl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 3-[cyclopropyl(ethyl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 114791269 |
| Molecular Formula | C11H14FNO4S2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3-[cyclopropyl(ethyl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | CCN(C1CC1)S(=O)(=O)c1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C11H14FNO4S2/c1-2-13(9-6-7-9)19(16,17)11-5-3-4-10(8-11)18(12,14)15/h3-5,8-9H,2,6-7H2,1H3 |
| InChIKey | SIZCEIQOMHOPGM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |