C11H16N2O5S2 — CID 166235680
3-N-ethyl-3-N-(oxetan-3-yl)benzene-1,3-disulfonamide (PubChem CID 166235680) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-N-ethyl-3-N-(oxetan-3-yl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-ethyl-3-N-(oxetan-3-yl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 166235680 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-N-ethyl-3-N-(oxetan-3-yl)benzene-1,3-disulfonamide |
| SMILES | CCN(C1COC1)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-2-13(9-7-18-8-9)20(16,17)11-5-3-4-10(6-11)19(12,14)15/h3-6,9H,2,7-8H2,1H3,(H2,12,14,15) |
| InChIKey | BVKDMQUJJZMWQE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |