C14H16BrClN2S — CID 114791433
4-bromo-5-[(4-chlorophenyl)methylsulfanylmethyl]-3-ethyl-1-methylpyrazole (PubChem CID 114791433) has the molecular formula C14H16BrClN2S and a molecular weight of 359.72 g/mol. Its IUPAC name is 4-bromo-5-[(4-chlorophenyl)methylsulfanylmethyl]-3-ethyl-1-methylpyrazole.
| Compound Name | 4-bromo-5-[(4-chlorophenyl)methylsulfanylmethyl]-3-ethyl-1-methylpyrazole |
|---|---|
| PubChem CID | 114791433 |
| Molecular Formula | C14H16BrClN2S |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 4-bromo-5-[(4-chlorophenyl)methylsulfanylmethyl]-3-ethyl-1-methylpyrazole |
| SMILES | CCc1nn(C)c(CSCc2ccc(Cl)cc2)c1Br |
| InChI | InChI=1S/C14H16BrClN2S/c1-3-12-14(15)13(18(2)17-12)9-19-8-10-4-6-11(16)7-5-10/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | OCDRZVHTDCEZPP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |