C12H22N4O2 — CID 114797096
1-(4-aminopyrazol-1-yl)-3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]propan-2-ol (PubChem CID 114797096) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(4-aminopyrazol-1-yl)-3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]propan-2-ol.
| Compound Name | 1-(4-aminopyrazol-1-yl)-3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 114797096 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(4-aminopyrazol-1-yl)-3-[3-(2-hydroxyethyl)pyrrolidin-1-yl]propan-2-ol |
| SMILES | Nc1cnn(CC(O)CN2CCC(CCO)C2)c1 |
| InChI | InChI=1S/C12H22N4O2/c13-11-5-14-16(7-11)9-12(18)8-15-3-1-10(6-15)2-4-17/h5,7,10,12,17-18H,1-4,6,8-9,13H2 |
| InChIKey | JCMWVOREMREVTE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |