C13H24N4O — CID 63623491
1-(4-aminopyrazol-1-yl)-3-(4-methylazepan-1-yl)propan-2-ol (PubChem CID 63623491) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-(4-aminopyrazol-1-yl)-3-(4-methylazepan-1-yl)propan-2-ol.
| Compound Name | 1-(4-aminopyrazol-1-yl)-3-(4-methylazepan-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 63623491 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 1-(4-aminopyrazol-1-yl)-3-(4-methylazepan-1-yl)propan-2-ol |
| SMILES | CC1CCCN(CC(O)Cn2cc(N)cn2)CC1 |
| InChI | InChI=1S/C13H24N4O/c1-11-3-2-5-16(6-4-11)9-13(18)10-17-8-12(14)7-15-17/h7-8,11,13,18H,2-6,9-10,14H2,1H3 |
| InChIKey | VEWROJAHBBAPQU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |