C14H23ClN2OS — CID 114797123
2-[1-[2-amino-1-(5-chlorothiophen-2-yl)butyl]pyrrolidin-3-yl]ethanol (PubChem CID 114797123) has the molecular formula C14H23ClN2OS and a molecular weight of 302.87 g/mol. Its IUPAC name is 2-[1-[2-amino-1-(5-chlorothiophen-2-yl)butyl]pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-[2-amino-1-(5-chlorothiophen-2-yl)butyl]pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 114797123 |
| Molecular Formula | C14H23ClN2OS |
| Molecular Weight | 302.87 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[1-[2-amino-1-(5-chlorothiophen-2-yl)butyl]pyrrolidin-3-yl]ethanol |
| SMILES | CCC(N)C(c1ccc(Cl)s1)N1CCC(CCO)C1 |
| InChI | InChI=1S/C14H23ClN2OS/c1-2-11(16)14(12-3-4-13(15)19-12)17-7-5-10(9-17)6-8-18/h3-4,10-11,14,18H,2,5-9,16H2,1H3 |
| InChIKey | YDHLKEWSYOKSBM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |