C16H26ClN3S — CID 79918784
1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-(5-chlorothiophen-2-yl)butan-2-amine (PubChem CID 79918784) has the molecular formula C16H26ClN3S and a molecular weight of 327.93 g/mol. Its IUPAC name is 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-(5-chlorothiophen-2-yl)butan-2-amine.
| Compound Name | 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-(5-chlorothiophen-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 79918784 |
| Molecular Formula | C16H26ClN3S |
| Molecular Weight | 327.93 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-(5-chlorothiophen-2-yl)butan-2-amine |
| SMILES | CCC(N)C(c1ccc(Cl)s1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C16H26ClN3S/c1-2-13(18)16(14-6-7-15(17)21-14)20-10-9-19-8-4-3-5-12(19)11-20/h6-7,12-13,16H,2-5,8-11,18H2,1H3 |
| InChIKey | ZOHQHWIAHGESFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.93 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |