C15H24ClN3S — CID 63150324
1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-(5-chlorothiophen-2-yl)propan-2-amine (PubChem CID 63150324) has the molecular formula C15H24ClN3S and a molecular weight of 313.90 g/mol. Its IUPAC name is 1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-(5-chlorothiophen-2-yl)propan-2-amine.
| Compound Name | 1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-(5-chlorothiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 63150324 |
| Molecular Formula | C15H24ClN3S |
| Molecular Weight | 313.90 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-(5-chlorothiophen-2-yl)propan-2-amine |
| SMILES | CC(N)C(c1ccc(Cl)s1)N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C15H24ClN3S/c1-11(17)15(13-5-6-14(16)20-13)19-9-3-8-18-7-2-4-12(18)10-19/h5-6,11-12,15H,2-4,7-10,17H2,1H3 |
| InChIKey | GNHVGRPBZYZXJC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |