C15H22N2O3 — CID 114799438
ethyl 3-amino-4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]benzoate (PubChem CID 114799438) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl 3-amino-4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-amino-4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 114799438 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethyl 3-amino-4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCC(CCO)C2)c(N)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-20-15(19)12-3-4-14(13(16)9-12)17-7-5-11(10-17)6-8-18/h3-4,9,11,18H,2,5-8,10,16H2,1H3 |
| InChIKey | UKAKHPFIPINADN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|