C14H18BrNO4S — CID 114801835
3-(2-bromoethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine (PubChem CID 114801835) has the molecular formula C14H18BrNO4S and a molecular weight of 376.27 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine.
| Compound Name | 3-(2-bromoethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 114801835 |
| Molecular Formula | C14H18BrNO4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 3-(2-bromoethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCC(CCBr)C1 |
| InChI | InChI=1S/C14H18BrNO4S/c15-5-3-11-4-6-16(10-11)21(17,18)12-1-2-13-14(9-12)20-8-7-19-13/h1-2,9,11H,3-8,10H2 |
| InChIKey | DQXIMOWJWXNWFH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|