C12H27N3O2S — CID 114803124
N-tert-butyl-3-[1-(methylamino)ethyl]piperidine-1-sulfonamide (PubChem CID 114803124) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N-tert-butyl-3-[1-(methylamino)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-tert-butyl-3-[1-(methylamino)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114803124 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-tert-butyl-3-[1-(methylamino)ethyl]piperidine-1-sulfonamide |
| SMILES | CNC(C)C1CCCN(S(=O)(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C12H27N3O2S/c1-10(13-5)11-7-6-8-15(9-11)18(16,17)14-12(2,3)4/h10-11,13-14H,6-9H2,1-5H3 |
| InChIKey | SAKMWUQUWMWQKV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |