C11H17N3O4S — CID 114804778
2-[2-amino-N-(propylsulfamoyl)anilino]acetic acid (PubChem CID 114804778) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[2-amino-N-(propylsulfamoyl)anilino]acetic acid.
| Compound Name | 2-[2-amino-N-(propylsulfamoyl)anilino]acetic acid |
|---|---|
| PubChem CID | 114804778 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[2-amino-N-(propylsulfamoyl)anilino]acetic acid |
| SMILES | CCCNS(=O)(=O)N(CC(=O)O)c1ccccc1N |
| InChI | InChI=1S/C11H17N3O4S/c1-2-7-13-19(17,18)14(8-11(15)16)10-6-4-3-5-9(10)12/h3-6,13H,2,7-8,12H2,1H3,(H,15,16) |
| InChIKey | MHXPJPZIFJCNSA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|