C13H21N3O4S — CID 63118493
3-(2-amino-N-[methyl(propan-2-yl)sulfamoyl]anilino)propanoic acid (PubChem CID 63118493) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-(2-amino-N-[methyl(propan-2-yl)sulfamoyl]anilino)propanoic acid.
| Compound Name | 3-(2-amino-N-[methyl(propan-2-yl)sulfamoyl]anilino)propanoic acid |
|---|---|
| PubChem CID | 63118493 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-(2-amino-N-[methyl(propan-2-yl)sulfamoyl]anilino)propanoic acid |
| SMILES | CC(C)N(C)S(=O)(=O)N(CCC(=O)O)c1ccccc1N |
| InChI | InChI=1S/C13H21N3O4S/c1-10(2)15(3)21(19,20)16(9-8-13(17)18)12-7-5-4-6-11(12)14/h4-7,10H,8-9,14H2,1-3H3,(H,17,18) |
| InChIKey | RVVPHLRSXPCLHR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|