C8H17F3N2O2S — CID 114807269
2-ethyl-N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine (PubChem CID 114807269) has the molecular formula C8H17F3N2O2S and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-ethyl-N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine.
| Compound Name | 2-ethyl-N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine |
|---|---|
| PubChem CID | 114807269 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-ethyl-N-(2,2,2-trifluoroethylsulfamoyl)butan-1-amine |
| SMILES | CCC(CC)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O2S/c1-3-7(4-2)5-12-16(14,15)13-6-8(9,10)11/h7,12-13H,3-6H2,1-2H3 |
| InChIKey | FNKQJIHATIDOFA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |