C9H20F3N3O2S — CID 114145477
2-propyl-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine (PubChem CID 114145477) has the molecular formula C9H20F3N3O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-propyl-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine.
| Compound Name | 2-propyl-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 114145477 |
| Molecular Formula | C9H20F3N3O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-propyl-N-(2,2,2-trifluoroethylsulfamoyl)butane-1,4-diamine |
| SMILES | CCCC(CCN)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H20F3N3O2S/c1-2-3-8(4-5-13)6-14-18(16,17)15-7-9(10,11)12/h8,14-15H,2-7,13H2,1H3 |
| InChIKey | HVVQFPOBSBYDEG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |