C11H23F3N2O2S — CID 106116361
N-[2-(2-aminoethyl)pentyl]-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 106116361) has the molecular formula C11H23F3N2O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[2-(2-aminoethyl)pentyl]-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-[2-(2-aminoethyl)pentyl]-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 106116361 |
| Molecular Formula | C11H23F3N2O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[2-(2-aminoethyl)pentyl]-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCCC(CCN)CNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H23F3N2O2S/c1-2-4-10(5-7-15)9-16-19(17,18)8-3-6-11(12,13)14/h10,16H,2-9,15H2,1H3 |
| InChIKey | MTMUQUIEOVMVMS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |