C12H22F5NO2S — CID 142793501
5,5,6,6,6-pentafluoro-N-hexylhexane-2-sulfonamide (PubChem CID 142793501) has the molecular formula C12H22F5NO2S and a molecular weight of 339.37 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-N-hexylhexane-2-sulfonamide.
| Compound Name | 5,5,6,6,6-pentafluoro-N-hexylhexane-2-sulfonamide |
|---|---|
| PubChem CID | 142793501 |
| Molecular Formula | C12H22F5NO2S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-N-hexylhexane-2-sulfonamide |
| SMILES | CCCCCCNS(=O)(=O)C(C)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO2S/c1-3-4-5-6-9-18-21(19,20)10(2)7-8-11(13,14)12(15,16)17/h10,18H,3-9H2,1-2H3 |
| InChIKey | CYAJIWIKDAKEHR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|