C8H10F9NO2S — CID 86068657
N-butyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 86068657) has the molecular formula C8H10F9NO2S and a molecular weight of 355.22 g/mol. Its IUPAC name is N-butyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-butyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 86068657 |
| Molecular Formula | C8H10F9NO2S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-butyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | CCCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F9NO2S/c1-2-3-4-18-21(19,20)8(16,17)6(11,12)5(9,10)7(13,14)15/h18H,2-4H2,1H3 |
| InChIKey | VTHLFEHATZVBSK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|