C12H22F3NO2S — CID 18360967
N-(2-cyclohexylethyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 18360967) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(2-cyclohexylethyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 18360967 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-(2-cyclohexylethyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCCC1CCCCC1 |
| InChI | InChI=1S/C12H22F3NO2S/c13-12(14,15)8-4-10-19(17,18)16-9-7-11-5-2-1-3-6-11/h11,16H,1-10H2 |
| InChIKey | CDOWJTYHIJLGME-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |