C8H18F2N2O2S — CID 106116380
N-[2-(2-aminoethyl)pentyl]-1,1-difluoromethanesulfonamide (PubChem CID 106116380) has the molecular formula C8H18F2N2O2S and a molecular weight of 244.31 g/mol. Its IUPAC name is N-[2-(2-aminoethyl)pentyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[2-(2-aminoethyl)pentyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 106116380 |
| Molecular Formula | C8H18F2N2O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-[2-(2-aminoethyl)pentyl]-1,1-difluoromethanesulfonamide |
| SMILES | CCCC(CCN)CNS(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H18F2N2O2S/c1-2-3-7(4-5-11)6-12-15(13,14)8(9)10/h7-8,12H,2-6,11H2,1H3 |
| InChIKey | UMXVWKCEZZGPGG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |