C13H25F6N2O4S2- — CID 159813378
bis(trifluoromethylsulfonyl)azanide;5-ethylnonan-1-amine (PubChem CID 159813378) has the molecular formula C13H25F6N2O4S2- and a molecular weight of 451.48 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;5-ethylnonan-1-amine.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;5-ethylnonan-1-amine |
|---|---|
| PubChem CID | 159813378 |
| Molecular Formula | C13H25F6N2O4S2- |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;5-ethylnonan-1-amine |
| SMILES | CCCCC(CC)CCCCN.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H25N.C2F6NO4S2/c1-3-5-8-11(4-2)9-6-7-10-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h11H,3-10,12H2,1-2H3;/q;-1 |
| InChIKey | NLHSVRFSVZYFRU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|