About bis(trifluoromethylsulfonyl)azanide;heptylazanium
bis(trifluoromethylsulfonyl)azanide;heptylazanium (PubChem CID 141148409) has the molecular formula C9H18F6N2O4S2
and a molecular weight of 396.38 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;heptylazanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;heptylazanium |
| PubChem CID | 141148409 |
| Molecular Formula | C9H18F6N2O4S2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;heptylazanium |
| SMILES | CCCCCCC[NH3+].O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H17N.C2F6NO4S2/c1-2-3-4-5-6-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-8H2,1H3;/q;-1/p+1 |
| InChIKey | GJSCBOCABRWECL-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;heptylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;heptylazanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;heptylazanium (CID 141148409) is bis(trifluoromethylsulfonyl)azanide;heptylazanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;heptylazanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;heptylazanium is CCCCCCC[NH3+].O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;heptylazanium?
The InChIKey is GJSCBOCABRWECL-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H17N.C2F6NO4S2/c1-2-3-4-5-6-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-8H2,1H3;/q;-1/p+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;heptylazanium?
bis(trifluoromethylsulfonyl)azanide;heptylazanium has a molecular weight of 396.38 g/mol, XLogP of 2.26, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;heptylazanium is sourced from PubChem (CID 141148409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).