C9H20F3NO2S — CID 165393913
ethane;N-[3-(trifluoromethyl)pentan-2-yl]methanesulfonamide (PubChem CID 165393913) has the molecular formula C9H20F3NO2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethane;N-[3-(trifluoromethyl)pentan-2-yl]methanesulfonamide.
| Compound Name | ethane;N-[3-(trifluoromethyl)pentan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165393913 |
| Molecular Formula | C9H20F3NO2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethane;N-[3-(trifluoromethyl)pentan-2-yl]methanesulfonamide |
| SMILES | CC.CCC(C(C)NS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S.C2H6/c1-4-6(7(8,9)10)5(2)11-14(3,12)13;1-2/h5-6,11H,4H2,1-3H3;1-2H3 |
| InChIKey | TXDYLYLPFISXCA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |