C7H16F2N2O2S — CID 43606286
N-(2-amino-4-methylpentyl)-1,1-difluoromethanesulfonamide (PubChem CID 43606286) has the molecular formula C7H16F2N2O2S and a molecular weight of 230.28 g/mol. Its IUPAC name is N-(2-amino-4-methylpentyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(2-amino-4-methylpentyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 43606286 |
| Molecular Formula | C7H16F2N2O2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-(2-amino-4-methylpentyl)-1,1-difluoromethanesulfonamide |
| SMILES | CC(C)CC(N)CNS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H16F2N2O2S/c1-5(2)3-6(10)4-11-14(12,13)7(8)9/h5-7,11H,3-4,10H2,1-2H3 |
| InChIKey | CNJJHNOKWPKJCD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |