C13H21N3O2S — CID 114807566
N-(tert-butylsulfamoyl)-1,2,3,4-tetrahydroisoquinolin-8-amine (PubChem CID 114807566) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(tert-butylsulfamoyl)-1,2,3,4-tetrahydroisoquinolin-8-amine.
| Compound Name | N-(tert-butylsulfamoyl)-1,2,3,4-tetrahydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 114807566 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(tert-butylsulfamoyl)-1,2,3,4-tetrahydroisoquinolin-8-amine |
| SMILES | CC(C)(C)NS(=O)(=O)Nc1cccc2c1CNCC2 |
| InChI | InChI=1S/C13H21N3O2S/c1-13(2,3)16-19(17,18)15-12-6-4-5-10-7-8-14-9-11(10)12/h4-6,14-16H,7-9H2,1-3H3 |
| InChIKey | APGSIVIZODXWEQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |