C8H14F3N3O2S — CID 114807722
2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile (PubChem CID 114807722) has the molecular formula C8H14F3N3O2S and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile.
| Compound Name | 2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
|---|---|
| PubChem CID | 114807722 |
| Molecular Formula | C8H14F3N3O2S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-ethyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
| SMILES | CCC(C#N)(CC)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2S/c1-3-7(4-2,5-12)14-17(15,16)13-6-8(9,10)11/h13-14H,3-4,6H2,1-2H3 |
| InChIKey | BOMNFEAIXITUJV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |