C7H12F3N3O2S — CID 114807715
2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile (PubChem CID 114807715) has the molecular formula C7H12F3N3O2S and a molecular weight of 259.25 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile.
| Compound Name | 2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
|---|---|
| PubChem CID | 114807715 |
| Molecular Formula | C7H12F3N3O2S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
| SMILES | CCC(C)(C#N)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H12F3N3O2S/c1-3-6(2,4-11)13-16(14,15)12-5-7(8,9)10/h12-13H,3,5H2,1-2H3 |
| InChIKey | NBRUQGRGPSQCCS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |