C5H8F3N3O2S — CID 114807666
2-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile (PubChem CID 114807666) has the molecular formula C5H8F3N3O2S and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile.
| Compound Name | 2-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile |
|---|---|
| PubChem CID | 114807666 |
| Molecular Formula | C5H8F3N3O2S |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfamoylamino)propanenitrile |
| SMILES | CC(C#N)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H8F3N3O2S/c1-4(2-9)11-14(12,13)10-3-5(6,7)8/h4,10-11H,3H2,1H3 |
| InChIKey | OKAMIYPICPHKME-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |