C5H12F3N3O2S — CID 114803651
2-N-(2,2,2-trifluoroethylsulfamoyl)propane-1,2-diamine (PubChem CID 114803651) has the molecular formula C5H12F3N3O2S and a molecular weight of 235.23 g/mol. Its IUPAC name is 2-N-(2,2,2-trifluoroethylsulfamoyl)propane-1,2-diamine.
| Compound Name | 2-N-(2,2,2-trifluoroethylsulfamoyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 114803651 |
| Molecular Formula | C5H12F3N3O2S |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-N-(2,2,2-trifluoroethylsulfamoyl)propane-1,2-diamine |
| SMILES | CC(CN)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H12F3N3O2S/c1-4(2-9)11-14(12,13)10-3-5(6,7)8/h4,10-11H,2-3,9H2,1H3 |
| InChIKey | XBHRWIMNFWHYCJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |