C3H7F3N2O2S — CID 140578437
(2S)-1,1,1-trifluoro-2-(sulfamoylamino)propane (PubChem CID 140578437) has the molecular formula C3H7F3N2O2S and a molecular weight of 192.16 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-(sulfamoylamino)propane.
| Compound Name | (2S)-1,1,1-trifluoro-2-(sulfamoylamino)propane |
|---|---|
| PubChem CID | 140578437 |
| Molecular Formula | C3H7F3N2O2S |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-(sulfamoylamino)propane |
| SMILES | C[C@H](NS(N)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C3H7F3N2O2S/c1-2(3(4,5)6)8-11(7,9)10/h2,8H,1H3,(H2,7,9,10)/t2-/m0/s1 |
| InChIKey | NNXWXFACFMKRBK-REOHCLBHSA-N |
| XLogP | -0.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |